C17H16BrN5O6S2 — CID 142861151
5-bromo-3-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfinamoyl]-1H-indole-2-carboxamide (PubChem CID 142861151) has the molecular formula C17H16BrN5O6S2 and a molecular weight of 530.38 g/mol. Its IUPAC name is 5-bromo-3-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfinamoyl]-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-3-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfinamoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 142861151 |
| Molecular Formula | C17H16BrN5O6S2 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 528.97 |
| IUPAC Name | 5-bromo-3-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfinamoyl]-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Br)cc2c1S(=O)NCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16BrN5O6S2/c18-10-1-6-14-13(9-10)16(15(22-14)17(19)24)30(27)20-7-8-21-31(28,29)12-4-2-11(3-5-12)23(25)26/h1-6,9,20-22H,7-8H2,(H2,19,24) |
| InChIKey | GFPMVNSBGWBMHJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 177.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|