C16H13Cl2N3O3S — CID 67375248
5-chloro-3-[(3-chlorophenyl)methylsulfamoyl]-1H-indole-2-carboxamide (PubChem CID 67375248) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is 5-chloro-3-[(3-chlorophenyl)methylsulfamoyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-chlorophenyl)methylsulfamoyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67375248 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 5-chloro-3-[(3-chlorophenyl)methylsulfamoyl]-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Cl)cc2c1S(=O)(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O3S/c17-10-3-1-2-9(6-10)8-20-25(23,24)15-12-7-11(18)4-5-13(12)21-14(15)16(19)22/h1-7,20-21H,8H2,(H2,19,22) |
| InChIKey | FJQWCXCJPNOHML-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |