C23H18Cl2N2O4S — CID 22401464
5-chloro-3-(3-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 22401464) has the molecular formula C23H18Cl2N2O4S and a molecular weight of 489.38 g/mol. Its IUPAC name is 5-chloro-3-(3-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(3-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22401464 |
| Molecular Formula | C23H18Cl2N2O4S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 5-chloro-3-(3-chlorophenyl)sulfonyl-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2[nH]c3ccc(Cl)cc3c2S(=O)(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H18Cl2N2O4S/c1-31-17-6-2-4-14(10-17)13-26-23(28)21-22(19-12-16(25)8-9-20(19)27-21)32(29,30)18-7-3-5-15(24)11-18/h2-12,27H,13H2,1H3,(H,26,28) |
| InChIKey | HPSYHXWPDMNLLU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |