C17H17Cl2N3O3S — CID 162220092
1-chloro-4-methylbenzene;5-chloro-3-(methylsulfamoyl)-1H-indole-2-carboxamide (PubChem CID 162220092) has the molecular formula C17H17Cl2N3O3S and a molecular weight of 414.31 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;5-chloro-3-(methylsulfamoyl)-1H-indole-2-carboxamide.
| Compound Name | 1-chloro-4-methylbenzene;5-chloro-3-(methylsulfamoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 162220092 |
| Molecular Formula | C17H17Cl2N3O3S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-chloro-4-methylbenzene;5-chloro-3-(methylsulfamoyl)-1H-indole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1c(C(N)=O)[nH]c2ccc(Cl)cc12.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10ClN3O3S.C7H7Cl/c1-13-18(16,17)9-6-4-5(11)2-3-7(6)14-8(9)10(12)15;1-6-2-4-7(8)5-3-6/h2-4,13-14H,1H3,(H2,12,15);2-5H,1H3 |
| InChIKey | ZTZRWTRMEFQHFS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |