C24H22ClFN3O3P — CID 15959039
5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-4-fluoro-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 15959039) has the molecular formula C24H22ClFN3O3P and a molecular weight of 485.88 g/mol. Its IUPAC name is 5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-4-fluoro-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-4-fluoro-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15959039 |
| Molecular Formula | C24H22ClFN3O3P |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 5-chloro-3-[(3,5-dimethylphenyl)-methoxyphosphoryl]-4-fluoro-N-(pyridin-3-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cc(C)cc(C)c1)c1c(C(=O)NCc2cccnc2)[nH]c2ccc(Cl)c(F)c12 |
| InChI | InChI=1S/C24H22ClFN3O3P/c1-14-9-15(2)11-17(10-14)33(31,32-3)23-20-19(7-6-18(25)21(20)26)29-22(23)24(30)28-13-16-5-4-8-27-12-16/h4-12,29H,13H2,1-3H3,(H,28,30) |
| InChIKey | RAGUCFGDMNVMFT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|