C19H18ClNO3 — CID 94830137
ethyl 3-(4-chlorophenyl)-5-ethoxy-1H-indole-2-carboxylate (PubChem CID 94830137) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-5-ethoxy-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-5-ethoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 94830137 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-5-ethoxy-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OCC)cc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO3/c1-3-23-14-9-10-16-15(11-14)17(12-5-7-13(20)8-6-12)18(21-16)19(22)24-4-2/h5-11,21H,3-4H2,1-2H3 |
| InChIKey | FSYAADDAUDYHJP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |