C18H17ClN2OS — CID 6623806
3-(4-chlorophenyl)sulfanyl-N-propyl-1H-indole-2-carboxamide (PubChem CID 6623806) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-propyl-1H-indole-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-propyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 6623806 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-propyl-1H-indole-2-carboxamide |
| SMILES | CCCNC(=O)c1[nH]c2ccccc2c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2OS/c1-2-11-20-18(22)16-17(14-5-3-4-6-15(14)21-16)23-13-9-7-12(19)8-10-13/h3-10,21H,2,11H2,1H3,(H,20,22) |
| InChIKey | DIIIJRWKAHPOBO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |