C20H13Cl2NS2 — CID 10453718
2,3-bis[(4-chlorophenyl)sulfanyl]-1H-indole (PubChem CID 10453718) has the molecular formula C20H13Cl2NS2 and a molecular weight of 402.37 g/mol. Its IUPAC name is 2,3-bis[(4-chlorophenyl)sulfanyl]-1H-indole.
| Compound Name | 2,3-bis[(4-chlorophenyl)sulfanyl]-1H-indole |
|---|---|
| PubChem CID | 10453718 |
| Molecular Formula | C20H13Cl2NS2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 2,3-bis[(4-chlorophenyl)sulfanyl]-1H-indole |
| SMILES | Clc1ccc(Sc2[nH]c3ccccc3c2Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H13Cl2NS2/c21-13-5-9-15(10-6-13)24-19-17-3-1-2-4-18(17)23-20(19)25-16-11-7-14(22)8-12-16/h1-12,23H |
| InChIKey | GWPYTINHVONGGQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |