C21H20ClNOS — CID 154707679
3-(4-chlorophenyl)sulfanyl-2-cyclohexyl-1H-quinolin-4-one (PubChem CID 154707679) has the molecular formula C21H20ClNOS and a molecular weight of 369.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-2-cyclohexyl-1H-quinolin-4-one.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-2-cyclohexyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 154707679 |
| Molecular Formula | C21H20ClNOS |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-2-cyclohexyl-1H-quinolin-4-one |
| SMILES | O=c1c(Sc2ccc(Cl)cc2)c(C2CCCCC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20ClNOS/c22-15-10-12-16(13-11-15)25-21-19(14-6-2-1-3-7-14)23-18-9-5-4-8-17(18)20(21)24/h4-5,8-14H,1-3,6-7H2,(H,23,24) |
| InChIKey | ZGFNYAPHRJSYRS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |