C25H24ClN3OS — CID 41301442
(10S,15S)-10-(4-chlorophenyl)-13-cyclohexyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one (PubChem CID 41301442) has the molecular formula C25H24ClN3OS and a molecular weight of 450.01 g/mol. Its IUPAC name is (10S,15S)-10-(4-chlorophenyl)-13-cyclohexyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one.
| Compound Name | (10S,15S)-10-(4-chlorophenyl)-13-cyclohexyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
|---|---|
| PubChem CID | 41301442 |
| Molecular Formula | C25H24ClN3OS |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (10S,15S)-10-(4-chlorophenyl)-13-cyclohexyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)[C@H](c3ccc(Cl)cc3)N2C(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C25H24ClN3OS/c26-16-12-10-15(11-13-16)23-22-19(18-8-4-5-9-20(18)27-22)14-21-24(30)28(25(31)29(21)23)17-6-2-1-3-7-17/h4-5,8-13,17,21,23,27H,1-3,6-7,14H2/t21-,23-/m0/s1 |
| InChIKey | AWTVDABNOMBANF-GMAHTHKFSA-N |
| XLogP | 5.60 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|