C28H30BrN3OS — CID 59767088
4-bromo-13-cyclohexyl-10-(4-propan-2-ylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 59767088) has the molecular formula C28H30BrN3OS and a molecular weight of 536.54 g/mol. Its IUPAC name is 4-bromo-13-cyclohexyl-10-(4-propan-2-ylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | 4-bromo-13-cyclohexyl-10-(4-propan-2-ylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 59767088 |
| Molecular Formula | C28H30BrN3OS |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 4-bromo-13-cyclohexyl-10-(4-propan-2-ylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | CC(C)c1ccc(C2c3[nH]c4ccc(Br)cc4c3CC3C(=O)N(C4CCCCC4)C(=S)N32)cc1 |
| InChI | InChI=1S/C28H30BrN3OS/c1-16(2)17-8-10-18(11-9-17)26-25-22(21-14-19(29)12-13-23(21)30-25)15-24-27(33)31(28(34)32(24)26)20-6-4-3-5-7-20/h8-14,16,20,24,26,30H,3-7,15H2,1-2H3 |
| InChIKey | QTXJWKVADOKWRC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|