C27H21BrClN3O2S — CID 59767050
4-bromo-13-[(4-chlorophenyl)methyl]-10-(4-methoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 59767050) has the molecular formula C27H21BrClN3O2S and a molecular weight of 566.91 g/mol. Its IUPAC name is 4-bromo-13-[(4-chlorophenyl)methyl]-10-(4-methoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | 4-bromo-13-[(4-chlorophenyl)methyl]-10-(4-methoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 59767050 |
| Molecular Formula | C27H21BrClN3O2S |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | 4-bromo-13-[(4-chlorophenyl)methyl]-10-(4-methoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Br)cc4c3CC3C(=O)N(Cc4ccc(Cl)cc4)C(=S)N32)cc1 |
| InChI | InChI=1S/C27H21BrClN3O2S/c1-34-19-9-4-16(5-10-19)25-24-21(20-12-17(28)6-11-22(20)30-24)13-23-26(33)31(27(35)32(23)25)14-15-2-7-18(29)8-3-15/h2-12,23,25,30H,13-14H2,1H3 |
| InChIKey | CWPCVRRFWANLAH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|