C21H21NOS — CID 154707683
3-cyclohexylsulfanyl-2-phenyl-1H-quinolin-4-one (PubChem CID 154707683) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-2-phenyl-1H-quinolin-4-one.
| Compound Name | 3-cyclohexylsulfanyl-2-phenyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 154707683 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-cyclohexylsulfanyl-2-phenyl-1H-quinolin-4-one |
| SMILES | O=c1c(SC2CCCCC2)c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21NOS/c23-20-17-13-7-8-14-18(17)22-19(15-9-3-1-4-10-15)21(20)24-16-11-5-2-6-12-16/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2,(H,22,23) |
| InChIKey | XEIQZFQQWNROBL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |