C28H27NO2 — CID 15342294
2-[4-[(2-phenyl-1H-indol-3-yl)methyl]phenyl]cyclohexane-1-carboxylic acid (PubChem CID 15342294) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[4-[(2-phenyl-1H-indol-3-yl)methyl]phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[4-[(2-phenyl-1H-indol-3-yl)methyl]phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 15342294 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[4-[(2-phenyl-1H-indol-3-yl)methyl]phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1c1ccc(Cc2c(-c3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27NO2/c30-28(31)24-12-5-4-10-22(24)20-16-14-19(15-17-20)18-25-23-11-6-7-13-26(23)29-27(25)21-8-2-1-3-9-21/h1-3,6-9,11,13-17,22,24,29H,4-5,10,12,18H2,(H,30,31) |
| InChIKey | RXOVASYSYIXABC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |