C18H21N3O4 — CID 163282616
cis-(1S,2R)-2-[4-[2-(hydroxyamino)-2-oxoethyl]-3-phenyl-1H-pyrazol-5-yl]cyclohexane-1-carboxylic acid (PubChem CID 163282616) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is cis-(1S,2R)-2-[4-[2-(hydroxyamino)-2-oxoethyl]-3-phenyl-1H-pyrazol-5-yl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[4-[2-(hydroxyamino)-2-oxoethyl]-3-phenyl-1H-pyrazol-5-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163282616 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | cis-(1S,2R)-2-[4-[2-(hydroxyamino)-2-oxoethyl]-3-phenyl-1H-pyrazol-5-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Cc1c(-c2ccccc2)n[nH]c1[C@@H]1CCCC[C@@H]1C(=O)O)NO |
| InChI | InChI=1S/C18H21N3O4/c22-15(21-25)10-14-16(11-6-2-1-3-7-11)19-20-17(14)12-8-4-5-9-13(12)18(23)24/h1-3,6-7,12-13,25H,4-5,8-10H2,(H,19,20)(H,21,22)(H,23,24)/t12-,13+/m1/s1 |
| InChIKey | LJWNMMBBWBKWGI-OLZOCXBDSA-N |
| XLogP | 2.48 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|