C23H19ClN2OS — CID 22513700
3-(4-chlorophenyl)sulfanyl-N-(2-phenylethyl)-1H-indole-2-carboxamide (PubChem CID 22513700) has the molecular formula C23H19ClN2OS and a molecular weight of 406.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-(2-phenylethyl)-1H-indole-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-(2-phenylethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22513700 |
| Molecular Formula | C23H19ClN2OS |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-(2-phenylethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1[nH]c2ccccc2c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2OS/c24-17-10-12-18(13-11-17)28-22-19-8-4-5-9-20(19)26-21(22)23(27)25-15-14-16-6-2-1-3-7-16/h1-13,26H,14-15H2,(H,25,27) |
| InChIKey | IZEQRCZKGFZWRT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |