C12H12ClN3O3 — CID 21473963
ethyl 3-(2-amino-4-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylate (PubChem CID 21473963) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is ethyl 3-(2-amino-4-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylate.
| Compound Name | ethyl 3-(2-amino-4-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylate |
|---|---|
| PubChem CID | 21473963 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | ethyl 3-(2-amino-4-chlorophenyl)-5-oxo-1,2-dihydropyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2N)[nH][nH]c1=O |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-19-12(18)9-10(15-16-11(9)17)7-4-3-6(13)5-8(7)14/h3-5H,2,14H2,1H3,(H2,15,16,17) |
| InChIKey | YGPAFNNQLWIXFA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|