C15H16ClNO2 — CID 23726084
ethyl 2-but-3-enyl-5-chloro-1H-indole-3-carboxylate (PubChem CID 23726084) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is ethyl 2-but-3-enyl-5-chloro-1H-indole-3-carboxylate.
| Compound Name | ethyl 2-but-3-enyl-5-chloro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 23726084 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | ethyl 2-but-3-enyl-5-chloro-1H-indole-3-carboxylate |
| SMILES | C=CCCc1[nH]c2ccc(Cl)cc2c1C(=O)OCC |
| InChI | InChI=1S/C15H16ClNO2/c1-3-5-6-13-14(15(18)19-4-2)11-9-10(16)7-8-12(11)17-13/h3,7-9,17H,1,4-6H2,2H3 |
| InChIKey | XFPIWIOMYLZITK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|