C14H15NO6S2 — CID 42942027
ethyl 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)methylsulfanyl]-4-oxo-1,3-thiazole-5-carboxylate (PubChem CID 42942027) has the molecular formula C14H15NO6S2 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)methylsulfanyl]-4-oxo-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)methylsulfanyl]-4-oxo-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 42942027 |
| Molecular Formula | C14H15NO6S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | ethyl 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)methylsulfanyl]-4-oxo-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)C1SC(SCc2cc(C(=O)OC)c(C)o2)=NC1=O |
| InChI | InChI=1S/C14H15NO6S2/c1-4-20-13(18)10-11(16)15-14(23-10)22-6-8-5-9(7(2)21-8)12(17)19-3/h5,10H,4,6H2,1-3H3 |
| InChIKey | ZPJJHOAHXWLDGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|