C10H13NO4 — CID 76851838
ethyl 5,6-dimethyl-2,4-dioxo-1H-pyridine-3-carboxylate (PubChem CID 76851838) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 5,6-dimethyl-2,4-dioxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 5,6-dimethyl-2,4-dioxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 76851838 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | ethyl 5,6-dimethyl-2,4-dioxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC(C)=C(C)C1=O |
| InChI | InChI=1S/C10H13NO4/c1-4-15-10(14)7-8(12)5(2)6(3)11-9(7)13/h7H,4H2,1-3H3,(H,11,13) |
| InChIKey | RKWCFLBUQBPGLH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|