C13H19NO5 — CID 123163602
ethyl 8-methoxy-2,4-dioxo-1-azaspiro[4.5]decane-3-carboxylate (PubChem CID 123163602) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 8-methoxy-2,4-dioxo-1-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl 8-methoxy-2,4-dioxo-1-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 123163602 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | ethyl 8-methoxy-2,4-dioxo-1-azaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC2(CCC(OC)CC2)C1=O |
| InChI | InChI=1S/C13H19NO5/c1-3-19-12(17)9-10(15)13(14-11(9)16)6-4-8(18-2)5-7-13/h8-9H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | HRSMOBJCSHVDDM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|