C18H22ClNO4 — CID 91599739
3-(4-chloro-2-methoxy-6-methylphenyl)-8-methoxy-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 91599739) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-6-methylphenyl)-8-methoxy-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(4-chloro-2-methoxy-6-methylphenyl)-8-methoxy-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91599739 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-(4-chloro-2-methoxy-6-methylphenyl)-8-methoxy-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cc(Cl)cc(C)c1C1C(=O)NC2(CCC(OC)CC2)C1=O |
| InChI | InChI=1S/C18H22ClNO4/c1-10-8-11(19)9-13(24-3)14(10)15-16(21)18(20-17(15)22)6-4-12(23-2)5-7-18/h8-9,12,15H,4-7H2,1-3H3,(H,20,22) |
| InChIKey | MGEGPBXKEREXIE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|