C21H27NO3 — CID 141228401
8-[(E)-prop-1-enoxy]-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 141228401) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 8-[(E)-prop-1-enoxy]-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(E)-prop-1-enoxy]-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 141228401 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 8-[(E)-prop-1-enoxy]-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | C/C=C/OC1CCC2(CC1)NC(=O)C(c1c(C)cc(C)cc1C)C2=O |
| InChI | InChI=1S/C21H27NO3/c1-5-10-25-16-6-8-21(9-7-16)19(23)18(20(24)22-21)17-14(3)11-13(2)12-15(17)4/h5,10-12,16,18H,6-9H2,1-4H3,(H,22,24)/b10-5+ |
| InChIKey | BLOIGQQTUOIEGY-BJMVGYQFSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|