C17H20ClNO3 — CID 91132647
3-(2-chloro-4,6-dimethylphenyl)-7-methyl-8-oxa-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 91132647) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylphenyl)-7-methyl-8-oxa-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2-chloro-4,6-dimethylphenyl)-7-methyl-8-oxa-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91132647 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylphenyl)-7-methyl-8-oxa-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)NC3(CCOC(C)C3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClNO3/c1-9-6-10(2)13(12(18)7-9)14-15(20)17(19-16(14)21)4-5-22-11(3)8-17/h6-7,11,14H,4-5,8H2,1-3H3,(H,19,21) |
| InChIKey | CBWBRQCTHYTKML-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|