C15H22O2 — CID 16655529
4-methyl-2-(2,4,6-trimethylphenyl)oxan-4-ol (PubChem CID 16655529) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-methyl-2-(2,4,6-trimethylphenyl)oxan-4-ol.
| Compound Name | 4-methyl-2-(2,4,6-trimethylphenyl)oxan-4-ol |
|---|---|
| PubChem CID | 16655529 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 4-methyl-2-(2,4,6-trimethylphenyl)oxan-4-ol |
| SMILES | Cc1cc(C)c(C2CC(C)(O)CCO2)c(C)c1 |
| InChI | InChI=1S/C15H22O2/c1-10-7-11(2)14(12(3)8-10)13-9-15(4,16)5-6-17-13/h7-8,13,16H,5-6,9H2,1-4H3 |
| InChIKey | YLPIBCYOUJVWRS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |