C23H30O2 — CID 10569042
(4R,5R)-2,2-dimethyl-4,5-bis(2,4,6-trimethylphenyl)-1,3-dioxolane (PubChem CID 10569042) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-bis(2,4,6-trimethylphenyl)-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-bis(2,4,6-trimethylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10569042 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-bis(2,4,6-trimethylphenyl)-1,3-dioxolane |
| SMILES | Cc1cc(C)c([C@H]2OC(C)(C)O[C@@H]2c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H30O2/c1-13-9-15(3)19(16(4)10-13)21-22(25-23(7,8)24-21)20-17(5)11-14(2)12-18(20)6/h9-12,21-22H,1-8H3/t21-,22-/m1/s1 |
| InChIKey | OLQLOQMWRRIAAN-FGZHOGPDSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |