C23H32O5 — CID 58304940
(2E,5S,9R,10S,11Z,14S,16S)-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-diol (PubChem CID 58304940) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (2E,5S,9R,10S,11Z,14S,16S)-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-diol.
| Compound Name | (2E,5S,9R,10S,11Z,14S,16S)-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-diol |
|---|---|
| PubChem CID | 58304940 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (2E,5S,9R,10S,11Z,14S,16S)-7,7,14,18,20-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-diol |
| SMILES | Cc1cc(C)c2c(c1)/C=C/C[C@@H]1OC(C)(C)O[C@@H]1[C@@H](O)/C=C\C[C@H](C)O[C@@H]2O |
| InChI | InChI=1S/C23H32O5/c1-14-12-15(2)20-17(13-14)9-7-11-19-21(28-23(4,5)27-19)18(24)10-6-8-16(3)26-22(20)25/h6-7,9-10,12-13,16,18-19,21-22,24-25H,8,11H2,1-5H3/b9-7+,10-6-/t16-,18-,19-,21+,22-/m0/s1 |
| InChIKey | MTTZSLNKMCSPOG-NWGOYUDNSA-N |
| XLogP | 3.94 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|