C31H38O7 — CID 90865734
(2E,5S,9S,14S)-20-methoxy-10-[(4-methoxyphenyl)methoxy]-7,7,14,18-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 90865734) has the molecular formula C31H38O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is (2E,5S,9S,14S)-20-methoxy-10-[(4-methoxyphenyl)methoxy]-7,7,14,18-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (2E,5S,9S,14S)-20-methoxy-10-[(4-methoxyphenyl)methoxy]-7,7,14,18-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 90865734 |
| Molecular Formula | C31H38O7 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | (2E,5S,9S,14S)-20-methoxy-10-[(4-methoxyphenyl)methoxy]-7,7,14,18-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COc1ccc(COC2C=CC[C@H](C)OC(=O)c3c(C)cc(OC)cc3/C=C/C[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C31H38O7/c1-20-17-25(34-6)18-23-10-8-12-27-29(38-31(3,4)37-27)26(11-7-9-21(2)36-30(32)28(20)23)35-19-22-13-15-24(33-5)16-14-22/h7-8,10-11,13-18,21,26-27,29H,9,12,19H2,1-6H3/b10-8+,11-7?/t21-,26?,27-,29+/m0/s1 |
| InChIKey | XHQZQDSHZLPYPU-GYCJOHCNSA-N |
| XLogP | 6.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|