C23H30O6 — CID 11003944
(2Z,6S,10R,11E,14R)-18,20-dimethoxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 11003944) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2Z,6S,10R,11E,14R)-18,20-dimethoxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (2Z,6S,10R,11E,14R)-18,20-dimethoxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 11003944 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2Z,6S,10R,11E,14R)-18,20-dimethoxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COc1cc2c(c(OC)c1)C(=O)O[C@H](C)C/C=C/[C@H]1OC(C)(C)O[C@H]1CC/C=C\2 |
| InChI | InChI=1S/C23H30O6/c1-15-9-8-12-19-18(28-23(2,3)29-19)11-7-6-10-16-13-17(25-4)14-20(26-5)21(16)22(24)27-15/h6,8,10,12-15,18-19H,7,9,11H2,1-5H3/b10-6-,12-8+/t15-,18+,19-/m1/s1 |
| InChIKey | QTDJFPOVMYKEBR-ATJMQWOFSA-N |
| XLogP | 4.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|