C24H32O8 — CID 58750064
(5R,11Z)-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),11,18,20-tetraene-10,16-dione (PubChem CID 58750064) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is (5R,11Z)-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),11,18,20-tetraene-10,16-dione.
| Compound Name | (5R,11Z)-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),11,18,20-tetraene-10,16-dione |
|---|---|
| PubChem CID | 58750064 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (5R,11Z)-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),11,18,20-tetraene-10,16-dione |
| SMILES | COCOc1cc(OC)cc2c1C(=O)OC(C)C/C=C\C(=O)C1OC(C)(C)O[C@@H]1CCC2 |
| InChI | InChI=1S/C24H32O8/c1-15-8-6-10-18(25)22-19(31-24(2,3)32-22)11-7-9-16-12-17(28-5)13-20(29-14-27-4)21(16)23(26)30-15/h6,10,12-13,15,19,22H,7-9,11,14H2,1-5H3/b10-6-/t15?,19-,22?/m1/s1 |
| InChIKey | QBELYJRXSVVVPQ-YLRYXCIESA-N |
| XLogP | 3.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|