C22H26O8 — CID 11122608
(2R,4R,6S,10S,12E,15S)-19-hydroxy-21-methoxy-8,8,15-trimethyl-3,7,9,16-tetraoxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione (PubChem CID 11122608) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (2R,4R,6S,10S,12E,15S)-19-hydroxy-21-methoxy-8,8,15-trimethyl-3,7,9,16-tetraoxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione.
| Compound Name | (2R,4R,6S,10S,12E,15S)-19-hydroxy-21-methoxy-8,8,15-trimethyl-3,7,9,16-tetraoxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione |
|---|---|
| PubChem CID | 11122608 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R,4R,6S,10S,12E,15S)-19-hydroxy-21-methoxy-8,8,15-trimethyl-3,7,9,16-tetraoxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione |
| SMILES | COc1cc(O)c2c(c1)[C@H]1O[C@@H]1C[C@@H]1OC(C)(C)O[C@@H]1C(=O)/C=C/C[C@H](C)OC2=O |
| InChI | InChI=1S/C22H26O8/c1-11-6-5-7-14(23)20-17(29-22(2,3)30-20)10-16-19(28-16)13-8-12(26-4)9-15(24)18(13)21(25)27-11/h5,7-9,11,16-17,19-20,24H,6,10H2,1-4H3/b7-5+/t11-,16+,17-,19+,20+/m0/s1 |
| InChIKey | RXCSWCNELIVGCA-NAJIVVMESA-N |
| XLogP | 2.83 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|