C26H35NO9 — CID 58623820
(2R,4S,6S,7S,9Z,12S)-6,7,16-trihydroxy-12-methyl-18-(4-morpholin-4-ylbutoxy)-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione (PubChem CID 58623820) has the molecular formula C26H35NO9 and a molecular weight of 505.56 g/mol. Its IUPAC name is (2R,4S,6S,7S,9Z,12S)-6,7,16-trihydroxy-12-methyl-18-(4-morpholin-4-ylbutoxy)-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione.
| Compound Name | (2R,4S,6S,7S,9Z,12S)-6,7,16-trihydroxy-12-methyl-18-(4-morpholin-4-ylbutoxy)-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione |
|---|---|
| PubChem CID | 58623820 |
| Molecular Formula | C26H35NO9 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (2R,4S,6S,7S,9Z,12S)-6,7,16-trihydroxy-12-methyl-18-(4-morpholin-4-ylbutoxy)-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione |
| SMILES | C[C@H]1C/C=C\C(=O)[C@@H](O)[C@@H](O)C[C@@H]2O[C@@H]2c2cc(OCCCCN3CCOCC3)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H35NO9/c1-16-5-4-6-19(28)24(31)21(30)15-22-25(36-22)18-13-17(14-20(29)23(18)26(32)35-16)34-10-3-2-7-27-8-11-33-12-9-27/h4,6,13-14,16,21-22,24-25,29-31H,2-3,5,7-12,15H2,1H3/b6-4-/t16-,21-,22-,24+,25+/m0/s1 |
| InChIKey | CDVDNJPVRLJFSY-QFDFUMSOSA-N |
| XLogP | 1.51 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|