C26H32N2O7 — CID 58304964
(4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-16-[4-(1H-imidazol-2-yl)butoxy]-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58304964) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-16-[4-(1H-imidazol-2-yl)butoxy]-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-16-[4-(1H-imidazol-2-yl)butoxy]-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58304964 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-9,10,18-trihydroxy-16-[4-(1H-imidazol-2-yl)butoxy]-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(OCCCCc3ncc[nH]3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C26H32N2O7/c1-16-9-10-21(30)25(32)20(29)7-5-6-18-14-19(15-22(31)24(18)26(33)35-17(16)2)34-13-4-3-8-23-27-11-12-28-23/h5-6,9-12,14-17,20,25,29,31-32H,3-4,7-8,13H2,1-2H3,(H,27,28)/b6-5+,10-9-/t16-,17+,20+,25+/m1/s1 |
| InChIKey | DVUVBXGAPQDXEF-SEJQHQNESA-N |
| XLogP | 2.96 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|