C24H28N2O7 — CID 59467250
(4S,5R,6Z,12E)-9,10,18-trihydroxy-16-(2-imidazol-1-ylethoxy)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 59467250) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is (4S,5R,6Z,12E)-9,10,18-trihydroxy-16-(2-imidazol-1-ylethoxy)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,12E)-9,10,18-trihydroxy-16-(2-imidazol-1-ylethoxy)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 59467250 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (4S,5R,6Z,12E)-9,10,18-trihydroxy-16-(2-imidazol-1-ylethoxy)-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)C(O)C(O)C/C=C/c2cc(OCCn3ccnc3)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C24H28N2O7/c1-15-6-7-20(28)23(30)19(27)5-3-4-17-12-18(32-11-10-26-9-8-25-14-26)13-21(29)22(17)24(31)33-16(15)2/h3-4,6-9,12-16,19,23,27,29-30H,5,10-11H2,1-2H3/b4-3+,7-6-/t15-,16+,19?,23?/m1/s1 |
| InChIKey | MMEMFLAUBZHAOW-QIVRSOCBSA-N |
| XLogP | 2.11 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |