C19H25NO4 — CID 143752242
(4S,5R,6E,9R,11E)-9,17-dihydroxy-4,5-dimethyl-15-(methylamino)-3-oxabicyclo[11.4.0]heptadeca-1(13),6,11,14,16-pentaen-2-one (PubChem CID 143752242) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (4S,5R,6E,9R,11E)-9,17-dihydroxy-4,5-dimethyl-15-(methylamino)-3-oxabicyclo[11.4.0]heptadeca-1(13),6,11,14,16-pentaen-2-one.
| Compound Name | (4S,5R,6E,9R,11E)-9,17-dihydroxy-4,5-dimethyl-15-(methylamino)-3-oxabicyclo[11.4.0]heptadeca-1(13),6,11,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 143752242 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (4S,5R,6E,9R,11E)-9,17-dihydroxy-4,5-dimethyl-15-(methylamino)-3-oxabicyclo[11.4.0]heptadeca-1(13),6,11,14,16-pentaen-2-one |
| SMILES | CNc1cc(O)c2c(c1)/C=C/C[C@H](O)C/C=C/[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C19H25NO4/c1-12-6-4-8-16(21)9-5-7-14-10-15(20-3)11-17(22)18(14)19(23)24-13(12)2/h4-7,10-13,16,20-22H,8-9H2,1-3H3/b6-4+,7-5+/t12-,13+,16-/m1/s1 |
| InChIKey | BWFPFOCCLCVBNK-KTVCPVJHSA-N |
| XLogP | 3.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|