C21H25NO9 — CID 143752264
2-[[(5R,6Z,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]amino]oxyacetic acid (PubChem CID 143752264) has the molecular formula C21H25NO9 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-[[(5R,6Z,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]amino]oxyacetic acid.
| Compound Name | 2-[[(5R,6Z,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 143752264 |
| Molecular Formula | C21H25NO9 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[[(5R,6Z,12E)-9,10,18-trihydroxy-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]amino]oxyacetic acid |
| SMILES | CC1OC(=O)c2c(O)cc(NOCC(=O)O)cc2/C=C/CC(O)C(O)C(=O)/C=C\[C@H]1C |
| InChI | InChI=1S/C21H25NO9/c1-11-6-7-16(24)20(28)15(23)5-3-4-13-8-14(22-30-10-18(26)27)9-17(25)19(13)21(29)31-12(11)2/h3-4,6-9,11-12,15,20,22-23,25,28H,5,10H2,1-2H3,(H,26,27)/b4-3+,7-6-/t11-,12?,15?,20?/m1/s1 |
| InChIKey | JDGKUESTLPYQEQ-MPOIWTMKSA-N |
| XLogP | 1.27 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|