C22H29NO5 — CID 165097055
(5R,6Z,9R,10S,12E)-16-(ethylamino)-9,10,18-trihydroxy-4,5-dimethyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one (PubChem CID 165097055) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (5R,6Z,9R,10S,12E)-16-(ethylamino)-9,10,18-trihydroxy-4,5-dimethyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one.
| Compound Name | (5R,6Z,9R,10S,12E)-16-(ethylamino)-9,10,18-trihydroxy-4,5-dimethyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 165097055 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (5R,6Z,9R,10S,12E)-16-(ethylamino)-9,10,18-trihydroxy-4,5-dimethyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
| SMILES | C=C1/C=C\[C@@H](C)C(C)OC(=O)c2c(O)cc(NCC)cc2/C=C/C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H29NO5/c1-5-23-17-11-16-7-6-8-18(24)21(26)14(3)10-9-13(2)15(4)28-22(27)20(16)19(25)12-17/h6-7,9-13,15,18,21,23-26H,3,5,8H2,1-2,4H3/b7-6+,10-9-/t13-,15?,18+,21-/m1/s1 |
| InChIKey | XRNFACIHNPHKSN-CMDFNROBSA-N |
| XLogP | 3.26 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |