C25H30O11 — CID 173478198
methyl 2-[[(4S,5R,6Z,9S,10S)-9,10-dihydroxy-18-(2-methoxy-2-oxoethoxy)-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]acetate (PubChem CID 173478198) has the molecular formula C25H30O11 and a molecular weight of 506.50 g/mol. Its IUPAC name is methyl 2-[[(4S,5R,6Z,9S,10S)-9,10-dihydroxy-18-(2-methoxy-2-oxoethoxy)-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]acetate.
| Compound Name | methyl 2-[[(4S,5R,6Z,9S,10S)-9,10-dihydroxy-18-(2-methoxy-2-oxoethoxy)-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]acetate |
|---|---|
| PubChem CID | 173478198 |
| Molecular Formula | C25H30O11 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | methyl 2-[[(4S,5R,6Z,9S,10S)-9,10-dihydroxy-18-(2-methoxy-2-oxoethoxy)-4,5-dimethyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]acetate |
| SMILES | COC(=O)COc1cc2c(c(OCC(=O)OC)c1)C(=O)O[C@@H](C)[C@H](C)/C=C\C(=O)[C@@H](O)[C@@H](O)CC=C2 |
| InChI | InChI=1S/C25H30O11/c1-14-8-9-19(27)24(30)18(26)7-5-6-16-10-17(34-12-21(28)32-3)11-20(35-13-22(29)33-4)23(16)25(31)36-15(14)2/h5-6,8-11,14-15,18,24,26,30H,7,12-13H2,1-4H3/b6-5?,9-8-/t14-,15+,18+,24+/m1/s1 |
| InChIKey | NWYYUMRVHIDSRJ-VURYYUHASA-N |
| XLogP | 1.24 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|