C24H30N2O7 — CID 121367041
(4R,6E,8S,10E)-16,18-dihydroxy-12-imino-4-methyl-8-(2-morpholin-4-yl-2-oxoethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 121367041) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is (4R,6E,8S,10E)-16,18-dihydroxy-12-imino-4-methyl-8-(2-morpholin-4-yl-2-oxoethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,6E,8S,10E)-16,18-dihydroxy-12-imino-4-methyl-8-(2-morpholin-4-yl-2-oxoethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 121367041 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (4R,6E,8S,10E)-16,18-dihydroxy-12-imino-4-methyl-8-(2-morpholin-4-yl-2-oxoethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | [H]/N=C1\C=C\C[C@H](OCC(=O)N2CCOCC2)/C=C/C[C@@H](C)OC(=O)c2c(O)cc(O)cc2C1 |
| InChI | InChI=1S/C24H30N2O7/c1-16-4-2-6-20(32-15-22(29)26-8-10-31-11-9-26)7-3-5-18(25)12-17-13-19(27)14-21(28)23(17)24(30)33-16/h2-3,5-6,13-14,16,20,25,27-28H,4,7-12,15H2,1H3/b5-3+,6-2+,25-18+/t16-,20-/m1/s1 |
| InChIKey | VHMXVHMPABPXSV-LCEWLTBZSA-N |
| XLogP | 2.36 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|