C27H37N2O9P — CID 58373240
[(4R,6E,8R,10E,12E)-18-hydroxy-4,8-dimethyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl]oxymethylphosphonic acid (PubChem CID 58373240) has the molecular formula C27H37N2O9P and a molecular weight of 564.57 g/mol. Its IUPAC name is [(4R,6E,8R,10E,12E)-18-hydroxy-4,8-dimethyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl]oxymethylphosphonic acid.
| Compound Name | [(4R,6E,8R,10E,12E)-18-hydroxy-4,8-dimethyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 58373240 |
| Molecular Formula | C27H37N2O9P |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(4R,6E,8R,10E,12E)-18-hydroxy-4,8-dimethyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl]oxymethylphosphonic acid |
| SMILES | C[C@@H]1C/C=C/[C@H](C)C/C=C/C(=N/OCC(=O)N2CCCCC2)Cc2cc(OCP(=O)(O)O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C27H37N2O9P/c1-19-8-6-10-20(2)38-27(32)26-21(15-23(16-24(26)30)36-18-39(33,34)35)14-22(11-7-9-19)28-37-17-25(31)29-12-4-3-5-13-29/h6-8,11,15-16,19-20,30H,3-5,9-10,12-14,17-18H2,1-2H3,(H2,33,34,35)/b8-6+,11-7+,28-22-/t19-,20+/m0/s1 |
| InChIKey | PWLJMVCRWDBWRC-WPFCZZMBSA-N |
| XLogP | 3.92 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|