C27H36N2O7 — CID 56970695
(4R,6E,8R,10E,12Z)-15-ethyl-8,16,18-trihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 56970695) has the molecular formula C27H36N2O7 and a molecular weight of 500.59 g/mol. Its IUPAC name is (4R,6E,8R,10E,12Z)-15-ethyl-8,16,18-trihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (4R,6E,8R,10E,12Z)-15-ethyl-8,16,18-trihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 56970695 |
| Molecular Formula | C27H36N2O7 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (4R,6E,8R,10E,12Z)-15-ethyl-8,16,18-trihydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | CCc1c(O)cc(O)c2c1CC(=N/OCC(=O)N1CCCCC1)/C=C/C[C@@H](O)/C=C/C[C@@H](C)OC2=O |
| InChI | InChI=1S/C27H36N2O7/c1-3-21-22-15-19(28-35-17-25(33)29-13-5-4-6-14-29)10-8-12-20(30)11-7-9-18(2)36-27(34)26(22)24(32)16-23(21)31/h7-8,10-11,16,18,20,30-32H,3-6,9,12-15,17H2,1-2H3/b10-8+,11-7+,28-19+/t18-,20+/m1/s1 |
| InChIKey | BTGPNMUCGQJDOS-CDNGIKJNSA-N |
| XLogP | 3.40 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|