C27H35ClN2O5 — CID 89167153
(4R,6E,10E,12E)-15-chloro-18-ethyl-16-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 89167153) has the molecular formula C27H35ClN2O5 and a molecular weight of 503.04 g/mol. Its IUPAC name is (4R,6E,10E,12E)-15-chloro-18-ethyl-16-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,6E,10E,12E)-15-chloro-18-ethyl-16-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 89167153 |
| Molecular Formula | C27H35ClN2O5 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (4R,6E,10E,12E)-15-chloro-18-ethyl-16-hydroxy-4-methyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | CCc1cc(O)c(Cl)c2c1C(=O)O[C@H](C)C/C=C/CC/C=C/C(=N/OCC(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C27H35ClN2O5/c1-3-20-16-23(31)26(28)22-17-21(29-34-18-24(32)30-14-10-7-11-15-30)13-9-6-4-5-8-12-19(2)35-27(33)25(20)22/h5,8-9,13,16,19,31H,3-4,6-7,10-12,14-15,17-18H2,1-2H3/b8-5+,13-9+,29-21-/t19-/m1/s1 |
| InChIKey | PSOULOKIOJKUPZ-XIXBLPNDSA-N |
| XLogP | 5.38 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|