C25H32ClN2O9P — CID 44826115
[(4R,6E,10E)-15-chloro-18-hydroxy-4-methyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl] dihydrogen phosphate (PubChem CID 44826115) has the molecular formula C25H32ClN2O9P and a molecular weight of 570.96 g/mol. Its IUPAC name is [(4R,6E,10E)-15-chloro-18-hydroxy-4-methyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl] dihydrogen phosphate.
| Compound Name | [(4R,6E,10E)-15-chloro-18-hydroxy-4-methyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 44826115 |
| Molecular Formula | C25H32ClN2O9P |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | [(4R,6E,10E)-15-chloro-18-hydroxy-4-methyl-2-oxo-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-16-yl] dihydrogen phosphate |
| SMILES | C[C@@H]1C/C=C/CC/C=C/C(=NOCC(=O)N2CCCCC2)Cc2c(Cl)c(OP(=O)(O)O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C25H32ClN2O9P/c1-17-10-6-3-2-4-7-11-18(27-35-16-22(30)28-12-8-5-9-13-28)14-19-23(25(31)36-17)20(29)15-21(24(19)26)37-38(32,33)34/h3,6-7,11,15,17,29H,2,4-5,8-10,12-14,16H2,1H3,(H2,32,33,34)/b6-3+,11-7+,27-18?/t17-/m1/s1 |
| InChIKey | HPEVSJXMYKGEFX-FKWOQWHOSA-N |
| XLogP | 4.29 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|