C26H34ClN3O6 — CID 58421999
(6E,10E,12Z)-4-(2-aminoethyl)-15-chloro-16,18-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58421999) has the molecular formula C26H34ClN3O6 and a molecular weight of 520.03 g/mol. Its IUPAC name is (6E,10E,12Z)-4-(2-aminoethyl)-15-chloro-16,18-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-4-(2-aminoethyl)-15-chloro-16,18-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58421999 |
| Molecular Formula | C26H34ClN3O6 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (6E,10E,12Z)-4-(2-aminoethyl)-15-chloro-16,18-dihydroxy-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | NCCC1C/C=C/CC/C=C/C(=N\OCC(=O)N2CCCCC2)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H34ClN3O6/c27-25-20-15-18(29-35-17-23(33)30-13-7-4-8-14-30)9-5-2-1-3-6-10-19(11-12-28)36-26(34)24(20)21(31)16-22(25)32/h3,5-6,9,16,19,31-32H,1-2,4,7-8,10-15,17,28H2/b6-3+,9-5+,29-18+ |
| InChIKey | GIDOLKGMRIGTES-NXCDIYPZSA-N |
| XLogP | 3.85 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|