C25H31ClN2O5 — CID 143836003
(5E,9E,11E)-14-chloro-17-ethyl-15-hydroxy-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one (PubChem CID 143836003) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is (5E,9E,11E)-14-chloro-17-ethyl-15-hydroxy-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one.
| Compound Name | (5E,9E,11E)-14-chloro-17-ethyl-15-hydroxy-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 143836003 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (5E,9E,11E)-14-chloro-17-ethyl-15-hydroxy-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one |
| SMILES | CCc1cc(O)c(Cl)c2c1C(=O)OC/C=C/CC/C=C/C(=N/OCC(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C25H31ClN2O5/c1-2-18-15-21(29)24(26)20-16-19(27-33-17-22(30)28-12-8-6-9-13-28)11-7-4-3-5-10-14-32-25(31)23(18)20/h5,7,10-11,15,29H,2-4,6,8-9,12-14,16-17H2,1H3/b10-5+,11-7+,27-19- |
| InChIKey | WHMFAAMLSOPMTM-WIQXGVRQSA-N |
| XLogP | 4.60 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|