C26H34ClN3O3 — CID 58373256
(6E,10E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-azabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58373256) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is (6E,10E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-azabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-azabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58373256 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (6E,10E,12E)-15-chloro-16,18-dimethyl-12-(2-oxo-2-piperidin-1-ylethoxy)imino-3-azabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1Cl)CC(=N\OCC(=O)N1CCCCC1)/C=C/CC/C=C/CCNC2=O |
| InChI | InChI=1S/C26H34ClN3O3/c1-19-16-20(2)25(27)22-17-21(29-33-18-23(31)30-14-10-7-11-15-30)12-8-5-3-4-6-9-13-28-26(32)24(19)22/h4,6,8,12,16H,3,5,7,9-11,13-15,17-18H2,1-2H3,(H,28,32)/b6-4+,12-8+,29-21- |
| InChIKey | KGSVBPWLIKPDLX-JAFKWLPZSA-N |
| XLogP | 4.91 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|