C27H35ClN2O4 — CID 123434854
(6E,12Z)-15-chloro-16,18-dimethyl-12-[2-(3-methylpiperidin-1-yl)-2-oxoethoxy]imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 123434854) has the molecular formula C27H35ClN2O4 and a molecular weight of 487.04 g/mol. Its IUPAC name is (6E,12Z)-15-chloro-16,18-dimethyl-12-[2-(3-methylpiperidin-1-yl)-2-oxoethoxy]imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,12Z)-15-chloro-16,18-dimethyl-12-[2-(3-methylpiperidin-1-yl)-2-oxoethoxy]imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 123434854 |
| Molecular Formula | C27H35ClN2O4 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (6E,12Z)-15-chloro-16,18-dimethyl-12-[2-(3-methylpiperidin-1-yl)-2-oxoethoxy]imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1Cl)C/C(=N/OCC(=O)N1CCCC(C)C1)C=CCC/C=C/CCOC2=O |
| InChI | InChI=1S/C27H35ClN2O4/c1-19-11-10-13-30(17-19)24(31)18-34-29-22-12-8-6-4-5-7-9-14-33-27(32)25-20(2)15-21(3)26(28)23(25)16-22/h5,7-8,12,15,19H,4,6,9-11,13-14,16-18H2,1-3H3/b7-5+,12-8?,29-22+ |
| InChIKey | MAYNIKZXVGQIKZ-MMROOCCUSA-N |
| XLogP | 5.58 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|