C24H30N2O5 — CID 121367050
(5E,9E,11E)-15-hydroxy-17-methyl-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one (PubChem CID 121367050) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (5E,9E,11E)-15-hydroxy-17-methyl-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one.
| Compound Name | (5E,9E,11E)-15-hydroxy-17-methyl-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 121367050 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (5E,9E,11E)-15-hydroxy-17-methyl-11-(2-oxo-2-piperidin-1-ylethoxy)imino-3-oxabicyclo[11.4.0]heptadeca-1(13),5,9,14,16-pentaen-2-one |
| SMILES | Cc1cc(O)cc2c1C(=O)OC/C=C/CC/C=C/C(=N/OCC(=O)N1CCCCC1)C2 |
| InChI | InChI=1S/C24H30N2O5/c1-18-14-21(27)16-19-15-20(25-31-17-22(28)26-11-7-5-8-12-26)10-6-3-2-4-9-13-30-24(29)23(18)19/h4,6,9-10,14,16,27H,2-3,5,7-8,11-13,15,17H2,1H3/b9-4+,10-6+,25-20- |
| InChIKey | IYOHLEJNMDSHLK-SKHAAQJFSA-N |
| XLogP | 3.69 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|