C29H39N3O7 — CID 89166990
tert-butyl 4-[2-[(Z)-[(6E,10E)-16-hydroxy-18-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetyl]piperazine-1-carboxylate (PubChem CID 89166990) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[(Z)-[(6E,10E)-16-hydroxy-18-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(Z)-[(6E,10E)-16-hydroxy-18-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89166990 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | tert-butyl 4-[2-[(Z)-[(6E,10E)-16-hydroxy-18-methyl-2-oxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-12-ylidene]amino]oxyacetyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(O)cc2c1C(=O)OCC/C=C/CC/C=C/C(=N\OCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1)C2 |
| InChI | InChI=1S/C29H39N3O7/c1-21-17-24(33)19-22-18-23(11-9-7-5-6-8-10-16-37-27(35)26(21)22)30-38-20-25(34)31-12-14-32(15-13-31)28(36)39-29(2,3)4/h6,8-9,11,17,19,33H,5,7,10,12-16,18,20H2,1-4H3/b8-6+,11-9+,30-23+ |
| InChIKey | JRMVEOGNEOMVCK-KMGOIXJNSA-N |
| XLogP | 4.15 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|