C27H36N2O5 — CID 58373243
(6E,10E,12Z)-12-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one (PubChem CID 58373243) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is (6E,10E,12Z)-12-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-12-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 58373243 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (6E,10E,12Z)-12-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1)CC(=N/OCC(=O)N1CC(C)OC(C)C1)/C=C/CC/C=C/CCOC2=O |
| InChI | InChI=1S/C27H36N2O5/c1-19-13-20(2)26-23(14-19)15-24(11-9-7-5-6-8-10-12-32-27(26)31)28-33-18-25(30)29-16-21(3)34-22(4)17-29/h6,8-9,11,13-14,21-22H,5,7,10,12,15-18H2,1-4H3/b8-6+,11-9+,28-24+ |
| InChIKey | PZVKHFVNAYICTB-VYHPIFJYSA-N |
| XLogP | 4.31 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|